C11H15BrOS — CID 141011073
6-bromo-3,3-dimethyl-2,4,4a,5-tetrahydrothiochromen-4-ol (PubChem CID 141011073) has the molecular formula C11H15BrOS and a molecular weight of 275.21 g/mol. Its IUPAC name is 6-bromo-3,3-dimethyl-2,4,4a,5-tetrahydrothiochromen-4-ol.
| Compound Name | 6-bromo-3,3-dimethyl-2,4,4a,5-tetrahydrothiochromen-4-ol |
|---|---|
| PubChem CID | 141011073 |
| Molecular Formula | C11H15BrOS |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 6-bromo-3,3-dimethyl-2,4,4a,5-tetrahydrothiochromen-4-ol |
| SMILES | CC1(C)CSC2=CC=C(Br)CC2C1O |
| InChI | InChI=1S/C11H15BrOS/c1-11(2)6-14-9-4-3-7(12)5-8(9)10(11)13/h3-4,8,10,13H,5-6H2,1-2H3 |
| InChIKey | XVPQTGAVNNVYSB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |