C14H19OS+ — CID 163978675
4-(thiolan-1-ium-1-yl)-1,2,8,8a-tetrahydronaphthalen-1-ol (PubChem CID 163978675) has the molecular formula C14H19OS+ and a molecular weight of 235.37 g/mol. Its IUPAC name is 4-(thiolan-1-ium-1-yl)-1,2,8,8a-tetrahydronaphthalen-1-ol.
| Compound Name | 4-(thiolan-1-ium-1-yl)-1,2,8,8a-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 163978675 |
| Molecular Formula | C14H19OS+ |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 4-(thiolan-1-ium-1-yl)-1,2,8,8a-tetrahydronaphthalen-1-ol |
| SMILES | OC1CC=C([S+]2CCCC2)C2=CC=CCC21 |
| InChI | InChI=1S/C14H19OS/c15-13-7-8-14(16-9-3-4-10-16)12-6-2-1-5-11(12)13/h1-2,6,8,11,13,15H,3-5,7,9-10H2/q+1 |
| InChIKey | SWLDVJXQOMOQQN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|