C11H18OS2 — CID 10823379
(1S,6S)-6-[(1S)-1-(1,3-dithiolan-2-yl)ethyl]cyclohex-3-en-1-ol (PubChem CID 10823379) has the molecular formula C11H18OS2 and a molecular weight of 230.40 g/mol. Its IUPAC name is (1S,6S)-6-[(1S)-1-(1,3-dithiolan-2-yl)ethyl]cyclohex-3-en-1-ol.
| Compound Name | (1S,6S)-6-[(1S)-1-(1,3-dithiolan-2-yl)ethyl]cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 10823379 |
| Molecular Formula | C11H18OS2 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (1S,6S)-6-[(1S)-1-(1,3-dithiolan-2-yl)ethyl]cyclohex-3-en-1-ol |
| SMILES | C[C@H](C1SCCS1)[C@@H]1CC=CC[C@@H]1O |
| InChI | InChI=1S/C11H18OS2/c1-8(11-13-6-7-14-11)9-4-2-3-5-10(9)12/h2-3,8-12H,4-7H2,1H3/t8-,9-,10-/m0/s1 |
| InChIKey | XVAFXFWVJWIRFN-GUBZILKMSA-N |
| XLogP | 2.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|