C11H18OS2 — CID 13047888
[6-(1,3-dithiolan-2-yl)-1-methylcyclohex-3-en-1-yl]methanol (PubChem CID 13047888) has the molecular formula C11H18OS2 and a molecular weight of 230.40 g/mol. Its IUPAC name is [6-(1,3-dithiolan-2-yl)-1-methylcyclohex-3-en-1-yl]methanol.
| Compound Name | [6-(1,3-dithiolan-2-yl)-1-methylcyclohex-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 13047888 |
| Molecular Formula | C11H18OS2 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | [6-(1,3-dithiolan-2-yl)-1-methylcyclohex-3-en-1-yl]methanol |
| SMILES | CC1(CO)CC=CCC1C1SCCS1 |
| InChI | InChI=1S/C11H18OS2/c1-11(8-12)5-3-2-4-9(11)10-13-6-7-14-10/h2-3,9-10,12H,4-8H2,1H3 |
| InChIKey | DLZUEOJCEYNJOF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|