C12H22OS2 — CID 12000575
(2S,3R)-2-methyl-1-(2-methyl-1,3-dithian-2-yl)hex-5-en-3-ol (PubChem CID 12000575) has the molecular formula C12H22OS2 and a molecular weight of 246.44 g/mol. Its IUPAC name is (2S,3R)-2-methyl-1-(2-methyl-1,3-dithian-2-yl)hex-5-en-3-ol.
| Compound Name | (2S,3R)-2-methyl-1-(2-methyl-1,3-dithian-2-yl)hex-5-en-3-ol |
|---|---|
| PubChem CID | 12000575 |
| Molecular Formula | C12H22OS2 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | (2S,3R)-2-methyl-1-(2-methyl-1,3-dithian-2-yl)hex-5-en-3-ol |
| SMILES | C=CC[C@@H](O)[C@@H](C)CC1(C)SCCCS1 |
| InChI | InChI=1S/C12H22OS2/c1-4-6-11(13)10(2)9-12(3)14-7-5-8-15-12/h4,10-11,13H,1,5-9H2,2-3H3/t10-,11+/m0/s1 |
| InChIKey | QBLIGWHOMJCUMG-WDEREUQCSA-N |
| XLogP | 3.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|