C9H16OS — CID 14433338
2,4-dimethyl-2-[(E)-prop-1-enyl]thiolan-3-ol (PubChem CID 14433338) has the molecular formula C9H16OS and a molecular weight of 172.29 g/mol. Its IUPAC name is 2,4-dimethyl-2-[(E)-prop-1-enyl]thiolan-3-ol.
| Compound Name | 2,4-dimethyl-2-[(E)-prop-1-enyl]thiolan-3-ol |
|---|---|
| PubChem CID | 14433338 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 2,4-dimethyl-2-[(E)-prop-1-enyl]thiolan-3-ol |
| SMILES | C/C=C/C1(C)SCC(C)C1O |
| InChI | InChI=1S/C9H16OS/c1-4-5-9(3)8(10)7(2)6-11-9/h4-5,7-8,10H,6H2,1-3H3/b5-4+ |
| InChIKey | GOMNOWNKLMSYSS-SNAWJCMRSA-N |
| XLogP | 2.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|