About (1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol
(1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol (PubChem CID 134889640) has the molecular formula C9H12OS2
and a molecular weight of 200.33 g/mol. Its IUPAC name is (1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol.
Molecular Properties
| Compound Name | (1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol |
| PubChem CID | 134889640 |
| Molecular Formula | C9H12OS2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | (1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol |
| SMILES | O[C@H]1CC=C[C@H]1C=C1SCCS1 |
| InChI | InChI=1S/C9H12OS2/c10-8-3-1-2-7(8)6-9-11-4-5-12-9/h1-2,6-8,10H,3-5H2/t7-,8-/m0/s1 |
| InChIKey | JAOLWQQRUVRXSD-YUMQZZPRSA-N |
| XLogP | 2.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol?
The IUPAC name of (1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol (CID 134889640) is (1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol.
What is the SMILES notation for (1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol?
The canonical SMILES for (1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol is O[C@H]1CC=C[C@H]1C=C1SCCS1.
What is the InChIKey of (1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol?
The InChIKey is JAOLWQQRUVRXSD-YUMQZZPRSA-N. The full InChI is InChI=1S/C9H12OS2/c10-8-3-1-2-7(8)6-9-11-4-5-12-9/h1-2,6-8,10H,3-5H2/t7-,8-/m0/s1.
What are the key properties of (1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol?
(1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol has a molecular weight of 200.33 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-2-(1,3-dithiolan-2-ylidenemethyl)cyclopent-3-en-1-ol is sourced from PubChem (CID 134889640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).