About tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol
tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol (PubChem CID 142363886) has the molecular formula C16H32OS
and a molecular weight of 272.50 g/mol. Its IUPAC name is tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol.
Molecular Properties
| Compound Name | tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol |
| PubChem CID | 142363886 |
| Molecular Formula | C16H32OS |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol |
| SMILES | C=CCC(O)C1CC=CC1.CC(C)(C)S(C)(C)C |
| InChI | InChI=1S/C9H14O.C7H18S/c1-2-5-9(10)8-6-3-4-7-8;1-7(2,3)8(4,5)6/h2-4,8-10H,1,5-7H2;1-6H3 |
| InChIKey | JEPURLPRKRMZQX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol?
The IUPAC name of tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol (CID 142363886) is tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol.
What is the SMILES notation for tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol?
The canonical SMILES for tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol is C=CCC(O)C1CC=CC1.CC(C)(C)S(C)(C)C.
What is the InChIKey of tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol?
The InChIKey is JEPURLPRKRMZQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O.C7H18S/c1-2-5-9(10)8-6-3-4-7-8;1-7(2,3)8(4,5)6/h2-4,8-10H,1,5-7H2;1-6H3.
What are the key properties of tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol?
tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol has a molecular weight of 272.50 g/mol, XLogP of 4.37, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(trimethyl)-λ4-sulfane;1-cyclopent-3-en-1-ylbut-3-en-1-ol is sourced from PubChem (CID 142363886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).