C11H20OS2 — CID 11241764
(4R)-5-(1,3-dithian-2-ylidene)-4-methylhexan-2-ol (PubChem CID 11241764) has the molecular formula C11H20OS2 and a molecular weight of 232.41 g/mol. Its IUPAC name is (4R)-5-(1,3-dithian-2-ylidene)-4-methylhexan-2-ol.
| Compound Name | (4R)-5-(1,3-dithian-2-ylidene)-4-methylhexan-2-ol |
|---|---|
| PubChem CID | 11241764 |
| Molecular Formula | C11H20OS2 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (4R)-5-(1,3-dithian-2-ylidene)-4-methylhexan-2-ol |
| SMILES | CC(=C1SCCCS1)[C@H](C)CC(C)O |
| InChI | InChI=1S/C11H20OS2/c1-8(7-9(2)12)10(3)11-13-5-4-6-14-11/h8-9,12H,4-7H2,1-3H3/t8-,9?/m1/s1 |
| InChIKey | NMXGFHUEZINKIH-VEDVMXKPSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |