C14H20O7S — CID 11244463
ethyl 2-[[(2R,3S,6R)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]sulfanyl]acetate (PubChem CID 11244463) has the molecular formula C14H20O7S and a molecular weight of 332.37 g/mol. Its IUPAC name is ethyl 2-[[(2R,3S,6R)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[(2R,3S,6R)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 11244463 |
| Molecular Formula | C14H20O7S |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | ethyl 2-[[(2R,3S,6R)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CS[C@@H]1C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C14H20O7S/c1-4-18-13(17)8-22-14-6-5-11(20-10(3)16)12(21-14)7-19-9(2)15/h5-6,11-12,14H,4,7-8H2,1-3H3/t11-,12+,14+/m0/s1 |
| InChIKey | XIYVCVONISTAQQ-OUCADQQQSA-N |
| XLogP | 1.06 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|