C16H13ClN4O3S — CID 108798395
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-hydroxy-1-(3-methylphenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 108798395) has the molecular formula C16H13ClN4O3S and a molecular weight of 376.83 g/mol. Its IUPAC name is N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-hydroxy-1-(3-methylphenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-hydroxy-1-(3-methylphenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 108798395 |
| Molecular Formula | C16H13ClN4O3S |
| Molecular Weight | 376.83 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-hydroxy-1-(3-methylphenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | Cc1cccc(-n2nc(C(=O)Nc3nc(CCl)cs3)c(O)cc2=O)c1 |
| InChI | InChI=1S/C16H13ClN4O3S/c1-9-3-2-4-11(5-9)21-13(23)6-12(22)14(20-21)15(24)19-16-18-10(7-17)8-25-16/h2-6,8,22H,7H2,1H3,(H,18,19,24) |
| InChIKey | XKUORUSYJABGOW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.83 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|