C16H13ClN4O4S — CID 108798592
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-hydroxy-1-(2-methoxyphenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 108798592) has the molecular formula C16H13ClN4O4S and a molecular weight of 392.82 g/mol. Its IUPAC name is N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-hydroxy-1-(2-methoxyphenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-hydroxy-1-(2-methoxyphenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 108798592 |
| Molecular Formula | C16H13ClN4O4S |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-4-hydroxy-1-(2-methoxyphenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | COc1ccccc1-n1nc(C(=O)Nc2nc(CCl)cs2)c(O)cc1=O |
| InChI | InChI=1S/C16H13ClN4O4S/c1-25-12-5-3-2-4-10(12)21-13(23)6-11(22)14(20-21)15(24)19-16-18-9(7-17)8-26-16/h2-6,8,22H,7H2,1H3,(H,18,19,24) |
| InChIKey | LOSVADBDYNBCGB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|