C11H16N4O2S — CID 108800580
N-(2-acetamidoethyl)-2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)acetamide (PubChem CID 108800580) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 108800580 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-(2-acetamidoethyl)-2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)acetamide |
| SMILES | CC(=O)NCCNC(=O)CC1=CSC2=NCCN12 |
| InChI | InChI=1S/C11H16N4O2S/c1-8(16)12-2-3-13-10(17)6-9-7-18-11-14-4-5-15(9)11/h7H,2-6H2,1H3,(H,12,16)(H,13,17) |
| InChIKey | FHLHIDIYHXUXIZ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|