C18H21N3O3S — CID 108787557
butyl 2-[[2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)acetyl]amino]benzoate (PubChem CID 108787557) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is butyl 2-[[2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)acetyl]amino]benzoate.
| Compound Name | butyl 2-[[2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 108787557 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | butyl 2-[[2-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)CC1=CSC2=NCCN12 |
| InChI | InChI=1S/C18H21N3O3S/c1-2-3-10-24-17(23)14-6-4-5-7-15(14)20-16(22)11-13-12-25-18-19-8-9-21(13)18/h4-7,12H,2-3,8-11H2,1H3,(H,20,22) |
| InChIKey | BPNRAGRLNVLVFX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|