C14H25NO2Si — CID 10880073
1-[(2R)-4-(trimethylsilylmethyl)pent-4-en-2-yl]piperidine-2,6-dione (PubChem CID 10880073) has the molecular formula C14H25NO2Si and a molecular weight of 267.44 g/mol. Its IUPAC name is 1-[(2R)-4-(trimethylsilylmethyl)pent-4-en-2-yl]piperidine-2,6-dione.
| Compound Name | 1-[(2R)-4-(trimethylsilylmethyl)pent-4-en-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 10880073 |
| Molecular Formula | C14H25NO2Si |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-[(2R)-4-(trimethylsilylmethyl)pent-4-en-2-yl]piperidine-2,6-dione |
| SMILES | C=C(C[C@@H](C)N1C(=O)CCCC1=O)C[Si](C)(C)C |
| InChI | InChI=1S/C14H25NO2Si/c1-11(10-18(3,4)5)9-12(2)15-13(16)7-6-8-14(15)17/h12H,1,6-10H2,2-5H3/t12-/m1/s1 |
| InChIKey | ZSZQLMKURYBYPB-GFCCVEGCSA-N |
| XLogP | 3.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|