C10H17NO3 — CID 130893283
1-(3-hydroxypentan-2-yl)piperidine-2,6-dione (PubChem CID 130893283) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-(3-hydroxypentan-2-yl)piperidine-2,6-dione.
| Compound Name | 1-(3-hydroxypentan-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 130893283 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 1-(3-hydroxypentan-2-yl)piperidine-2,6-dione |
| SMILES | CCC(O)C(C)N1C(=O)CCCC1=O |
| InChI | InChI=1S/C10H17NO3/c1-3-8(12)7(2)11-9(13)5-4-6-10(11)14/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | KPNCBWOZHLLZGE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|