C26H27N5O3S — CID 108801855
N-[4-(cyclohexylsulfamoyl)phenyl]-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide (PubChem CID 108801855) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is N-[4-(cyclohexylsulfamoyl)phenyl]-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide.
| Compound Name | N-[4-(cyclohexylsulfamoyl)phenyl]-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 108801855 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | N-[4-(cyclohexylsulfamoyl)phenyl]-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(S(=O)(=O)NC3CCCCC3)cc2)cnn1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C26H27N5O3S/c1-18-23(17-27-31(18)25-16-11-19-7-5-6-10-24(19)29-25)26(32)28-20-12-14-22(15-13-20)35(33,34)30-21-8-3-2-4-9-21/h5-7,10-17,21,30H,2-4,8-9H2,1H3,(H,28,32) |
| InChIKey | GHZZWYZEDBIZNE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |