C21H15N5OS — CID 108788981
[4-[(5-methyl-1-quinolin-2-ylpyrazole-4-carbonyl)amino]phenyl] thiocyanate (PubChem CID 108788981) has the molecular formula C21H15N5OS and a molecular weight of 385.45 g/mol. Its IUPAC name is [4-[(5-methyl-1-quinolin-2-ylpyrazole-4-carbonyl)amino]phenyl] thiocyanate.
| Compound Name | [4-[(5-methyl-1-quinolin-2-ylpyrazole-4-carbonyl)amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108788981 |
| Molecular Formula | C21H15N5OS |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | [4-[(5-methyl-1-quinolin-2-ylpyrazole-4-carbonyl)amino]phenyl] thiocyanate |
| SMILES | Cc1c(C(=O)Nc2ccc(SC#N)cc2)cnn1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C21H15N5OS/c1-14-18(21(27)24-16-7-9-17(10-8-16)28-13-22)12-23-26(14)20-11-6-15-4-2-3-5-19(15)25-20/h2-12H,1H3,(H,24,27) |
| InChIKey | HVWXUPIIIBZTHU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|