C16H11F3N2O2 — CID 108803187
2-(5-methyl-1,2-benzoxazol-3-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 108803187) has the molecular formula C16H11F3N2O2 and a molecular weight of 320.27 g/mol. Its IUPAC name is 2-(5-methyl-1,2-benzoxazol-3-yl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(5-methyl-1,2-benzoxazol-3-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 108803187 |
| Molecular Formula | C16H11F3N2O2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-(5-methyl-1,2-benzoxazol-3-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Cc1ccc2onc(CC(=O)Nc3ccc(F)c(F)c3F)c2c1 |
| InChI | InChI=1S/C16H11F3N2O2/c1-8-2-5-13-9(6-8)12(21-23-13)7-14(22)20-11-4-3-10(17)15(18)16(11)19/h2-6H,7H2,1H3,(H,20,22) |
| InChIKey | FZUGUKRGRKWEOM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|