2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid

C17H14N2O4 — CID 108803274

IUPAC2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid
SMILESCc1ccc2onc(CC(=O)Nc3ccccc3C(=O)O)c2c1
InChIInChI=1S/C17H14N2O4/c1-10-6-7-15-12(8-10)14(19-23-15)9-16(20)18-13-5-3-2-4-11(13)17(21)22/h2-8H,9H2,1H3,(H,18,20)(H,21,22)
InChIKeyWDIPPMPRIRIYCO-UHFFFAOYSA-N
MW310.31 g/mol
LogP3.02
Rot. Bonds4

About 2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid

2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid (PubChem CID 108803274) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid.

Molecular Properties

Compound Name2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid
PubChem CID108803274
Molecular FormulaC17H14N2O4
Molecular Weight310.31 g/mol
Exact Mass310.10
IUPAC Name2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid
SMILESCc1ccc2onc(CC(=O)Nc3ccccc3C(=O)O)c2c1
InChIInChI=1S/C17H14N2O4/c1-10-6-7-15-12(8-10)14(19-23-15)9-16(20)18-13-5-3-2-4-11(13)17(21)22/h2-8H,9H2,1H3,(H,18,20)(H,21,22)
InChIKeyWDIPPMPRIRIYCO-UHFFFAOYSA-N
XLogP3.02
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.31
LogP ≤ 53.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid?
The IUPAC name of 2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid (CID 108803274) is 2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid.
What is the SMILES notation for 2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid?
The canonical SMILES for 2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid is Cc1ccc2onc(CC(=O)Nc3ccccc3C(=O)O)c2c1.
What is the InChIKey of 2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid?
The InChIKey is WDIPPMPRIRIYCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O4/c1-10-6-7-15-12(8-10)14(19-23-15)9-16(20)18-13-5-3-2-4-11(13)17(21)22/h2-8H,9H2,1H3,(H,18,20)(H,21,22).
What are the key properties of 2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid?
2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid has a molecular weight of 310.31 g/mol, XLogP of 3.02, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(5-methyl-1,2-benzoxazol-3-yl)acetyl]amino]benzoic acid is sourced from PubChem (CID 108803274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).