C16H22O4 — CID 10880424
(3S,3aR,4R,4aS,8aS)-4-(1,3-dioxolan-2-yl)-3-methyl-3a,4,4a,5,6,7,8,8a-octahydro-3H-benzo[f][2]benzofuran-1-one (PubChem CID 10880424) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (3S,3aR,4R,4aS,8aS)-4-(1,3-dioxolan-2-yl)-3-methyl-3a,4,4a,5,6,7,8,8a-octahydro-3H-benzo[f][2]benzofuran-1-one.
| Compound Name | (3S,3aR,4R,4aS,8aS)-4-(1,3-dioxolan-2-yl)-3-methyl-3a,4,4a,5,6,7,8,8a-octahydro-3H-benzo[f][2]benzofuran-1-one |
|---|---|
| PubChem CID | 10880424 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (3S,3aR,4R,4aS,8aS)-4-(1,3-dioxolan-2-yl)-3-methyl-3a,4,4a,5,6,7,8,8a-octahydro-3H-benzo[f][2]benzofuran-1-one |
| SMILES | C[C@@H]1OC(=O)C2=C[C@H]3CCCC[C@@H]3[C@@H](C3OCCO3)[C@H]21 |
| InChI | InChI=1S/C16H22O4/c1-9-13-12(15(17)20-9)8-10-4-2-3-5-11(10)14(13)16-18-6-7-19-16/h8-11,13-14,16H,2-7H2,1H3/t9-,10+,11-,13-,14+/m0/s1 |
| InChIKey | JSOGCTHMPMATHW-GGFUIZRSSA-N |
| XLogP | 2.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |