C21H32O4 — CID 163070536
(6aR,7S,8R,10aS)-7-[2-[(3S,5R)-5-methoxyoxolan-3-yl]ethyl]-7,8-dimethyl-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-3-one (PubChem CID 163070536) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (6aR,7S,8R,10aS)-7-[2-[(3S,5R)-5-methoxyoxolan-3-yl]ethyl]-7,8-dimethyl-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-3-one.
| Compound Name | (6aR,7S,8R,10aS)-7-[2-[(3S,5R)-5-methoxyoxolan-3-yl]ethyl]-7,8-dimethyl-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-3-one |
|---|---|
| PubChem CID | 163070536 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (6aR,7S,8R,10aS)-7-[2-[(3S,5R)-5-methoxyoxolan-3-yl]ethyl]-7,8-dimethyl-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-3-one |
| SMILES | CO[C@H]1C[C@H](CC[C@@]2(C)[C@H](C)CC[C@@]34COC(=O)C3=CCC[C@@H]42)CO1 |
| InChI | InChI=1S/C21H32O4/c1-14-7-10-21-13-25-19(22)16(21)5-4-6-17(21)20(14,2)9-8-15-11-18(23-3)24-12-15/h5,14-15,17-18H,4,6-13H2,1-3H3/t14-,15+,17-,18-,20+,21-/m1/s1 |
| InChIKey | AHCLMOYDFNPXEO-URHBSNRWSA-N |
| XLogP | 4.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |