C16H20N2O5 — CID 108805610
methyl 3-[[1-(2-methoxyethyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate (PubChem CID 108805610) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is methyl 3-[[1-(2-methoxyethyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[1-(2-methoxyethyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 108805610 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | methyl 3-[[1-(2-methoxyethyl)-5-oxopyrrolidine-3-carbonyl]amino]benzoate |
| SMILES | COCCN1CC(C(=O)Nc2cccc(C(=O)OC)c2)CC1=O |
| InChI | InChI=1S/C16H20N2O5/c1-22-7-6-18-10-12(9-14(18)19)15(20)17-13-5-3-4-11(8-13)16(21)23-2/h3-5,8,12H,6-7,9-10H2,1-2H3,(H,17,20) |
| InChIKey | XDAZGKOZIODRIF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |