C13H17N3O3 — CID 94046070
(3S)-1-(2-methoxyethyl)-5-oxo-N-pyridin-3-ylpyrrolidine-3-carboxamide (PubChem CID 94046070) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is (3S)-1-(2-methoxyethyl)-5-oxo-N-pyridin-3-ylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(2-methoxyethyl)-5-oxo-N-pyridin-3-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 94046070 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (3S)-1-(2-methoxyethyl)-5-oxo-N-pyridin-3-ylpyrrolidine-3-carboxamide |
| SMILES | COCCN1C[C@@H](C(=O)Nc2cccnc2)CC1=O |
| InChI | InChI=1S/C13H17N3O3/c1-19-6-5-16-9-10(7-12(16)17)13(18)15-11-3-2-4-14-8-11/h2-4,8,10H,5-7,9H2,1H3,(H,15,18)/t10-/m0/s1 |
| InChIKey | YMKMPDSXHDUTSV-JTQLQIEISA-N |
| XLogP | 0.51 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |