C15H18N2O4 — CID 108805961
2-[[2-(4,6-dimethyl-1,2-benzoxazol-3-yl)acetyl]amino]butanoic acid (PubChem CID 108805961) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[[2-(4,6-dimethyl-1,2-benzoxazol-3-yl)acetyl]amino]butanoic acid.
| Compound Name | 2-[[2-(4,6-dimethyl-1,2-benzoxazol-3-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 108805961 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[[2-(4,6-dimethyl-1,2-benzoxazol-3-yl)acetyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)Cc1noc2cc(C)cc(C)c12)C(=O)O |
| InChI | InChI=1S/C15H18N2O4/c1-4-10(15(19)20)16-13(18)7-11-14-9(3)5-8(2)6-12(14)21-17-11/h5-6,10H,4,7H2,1-3H3,(H,16,18)(H,19,20) |
| InChIKey | LRTNFKCMMYAMIT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |