C22H19N5O4S — CID 108808026
4-(3,4-dimethylphenyl)-N-[6-(4-nitrophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-oxobutanamide (PubChem CID 108808026) has the molecular formula C22H19N5O4S and a molecular weight of 449.49 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-N-[6-(4-nitrophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-oxobutanamide.
| Compound Name | 4-(3,4-dimethylphenyl)-N-[6-(4-nitrophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 108808026 |
| Molecular Formula | C22H19N5O4S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-N-[6-(4-nitrophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)Nc2nc3scc(-c4ccc([N+](=O)[O-])cc4)n3n2)cc1C |
| InChI | InChI=1S/C22H19N5O4S/c1-13-3-4-16(11-14(13)2)19(28)9-10-20(29)23-21-24-22-26(25-21)18(12-32-22)15-5-7-17(8-6-15)27(30)31/h3-8,11-12H,9-10H2,1-2H3,(H,23,25,29) |
| InChIKey | QAYZSXKCHRLVCU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|