C18H20N4O2S — CID 108727737
4-(3,4-dimethylphenyl)-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-4-oxobutanamide (PubChem CID 108727737) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-4-oxobutanamide.
| Compound Name | 4-(3,4-dimethylphenyl)-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 108727737 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)Nc2nc3sc(C)c(C)n3n2)cc1C |
| InChI | InChI=1S/C18H20N4O2S/c1-10-5-6-14(9-11(10)2)15(23)7-8-16(24)19-17-20-18-22(21-17)12(3)13(4)25-18/h5-6,9H,7-8H2,1-4H3,(H,19,21,24) |
| InChIKey | HCIDTCMAUQBJTI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |