C20H22N4O2S — CID 108727703
N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide (PubChem CID 108727703) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide.
| Compound Name | N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide |
|---|---|
| PubChem CID | 108727703 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide |
| SMILES | Cc1sc2nc(NC(=O)CCC(=O)c3ccc4c(c3)CCCC4)nn2c1C |
| InChI | InChI=1S/C20H22N4O2S/c1-12-13(2)27-20-22-19(23-24(12)20)21-18(26)10-9-17(25)16-8-7-14-5-3-4-6-15(14)11-16/h7-8,11H,3-6,9-10H2,1-2H3,(H,21,23,26) |
| InChIKey | OPKVPMSPYMIDLH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |