C16H21NO4 — CID 10880835
benzyl (4S)-2,2-dimethyl-4-(3-oxopropyl)-1,3-oxazolidine-3-carboxylate (PubChem CID 10880835) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is benzyl (4S)-2,2-dimethyl-4-(3-oxopropyl)-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4S)-2,2-dimethyl-4-(3-oxopropyl)-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10880835 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | benzyl (4S)-2,2-dimethyl-4-(3-oxopropyl)-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)OC[C@H](CCC=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO4/c1-16(2)17(14(12-21-16)9-6-10-18)15(19)20-11-13-7-4-3-5-8-13/h3-5,7-8,10,14H,6,9,11-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | ICMYCTQKZAAVAB-AWEZNQCLSA-N |
| XLogP | 2.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|