C27H24N6O — CID 108810887
(5-methyl-1-quinolin-2-ylpyrazol-4-yl)-(4-quinolin-2-ylpiperazin-1-yl)methanone (PubChem CID 108810887) has the molecular formula C27H24N6O and a molecular weight of 448.53 g/mol. Its IUPAC name is (5-methyl-1-quinolin-2-ylpyrazol-4-yl)-(4-quinolin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (5-methyl-1-quinolin-2-ylpyrazol-4-yl)-(4-quinolin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 108810887 |
| Molecular Formula | C27H24N6O |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (5-methyl-1-quinolin-2-ylpyrazol-4-yl)-(4-quinolin-2-ylpiperazin-1-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCN(c3ccc4ccccc4n3)CC2)cnn1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C27H24N6O/c1-19-22(18-28-33(19)26-13-11-21-7-3-5-9-24(21)30-26)27(34)32-16-14-31(15-17-32)25-12-10-20-6-2-4-8-23(20)29-25/h2-13,18H,14-17H2,1H3 |
| InChIKey | NJBOGJFQPZPTBQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |