C20H28N4O — CID 108820584
(Z)-2-cyano-3-[methyl-(1-methylpiperidin-4-yl)amino]-N-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 108820584) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is (Z)-2-cyano-3-[methyl-(1-methylpiperidin-4-yl)amino]-N-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[methyl-(1-methylpiperidin-4-yl)amino]-N-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108820584 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | (Z)-2-cyano-3-[methyl-(1-methylpiperidin-4-yl)amino]-N-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc(NC(=O)/C(C#N)=C\N(C)C2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C20H28N4O/c1-15(2)16-5-7-18(8-6-16)22-20(25)17(13-21)14-24(4)19-9-11-23(3)12-10-19/h5-8,14-15,19H,9-12H2,1-4H3,(H,22,25)/b17-14- |
| InChIKey | IDOCGDRUONGPEM-VKAVYKQESA-N |
| XLogP | 3.18 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|