C19H18N2O4 — CID 10882303
(3S,6S)-11-methoxy-13-oxa-4,20-diazatetracyclo[12.2.2.23,6.18,12]henicosa-1(16),8(19),9,11,14,17-hexaene-5,21-dione (PubChem CID 10882303) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is (3S,6S)-11-methoxy-13-oxa-4,20-diazatetracyclo[12.2.2.23,6.18,12]henicosa-1(16),8(19),9,11,14,17-hexaene-5,21-dione.
| Compound Name | (3S,6S)-11-methoxy-13-oxa-4,20-diazatetracyclo[12.2.2.23,6.18,12]henicosa-1(16),8(19),9,11,14,17-hexaene-5,21-dione |
|---|---|
| PubChem CID | 10882303 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (3S,6S)-11-methoxy-13-oxa-4,20-diazatetracyclo[12.2.2.23,6.18,12]henicosa-1(16),8(19),9,11,14,17-hexaene-5,21-dione |
| SMILES | COc1ccc2cc1Oc1ccc(cc1)C[C@@H]1NC(=O)[C@H](C2)NC1=O |
| InChI | InChI=1S/C19H18N2O4/c1-24-16-7-4-12-9-15-19(23)20-14(18(22)21-15)8-11-2-5-13(6-3-11)25-17(16)10-12/h2-7,10,14-15H,8-9H2,1H3,(H,20,23)(H,21,22)/t14-,15-/m0/s1 |
| InChIKey | SZSWTNRLEBTXKF-GJZGRUSLSA-N |
| XLogP | 1.57 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |