C17H19N3O3 — CID 108823303
4-[[(Z)-2-cyano-3-(3-methylpiperidin-1-yl)prop-2-enoyl]amino]benzoic acid (PubChem CID 108823303) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-(3-methylpiperidin-1-yl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-(3-methylpiperidin-1-yl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108823303 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-(3-methylpiperidin-1-yl)prop-2-enoyl]amino]benzoic acid |
| SMILES | CC1CCCN(/C=C(/C#N)C(=O)Nc2ccc(C(=O)O)cc2)C1 |
| InChI | InChI=1S/C17H19N3O3/c1-12-3-2-8-20(10-12)11-14(9-18)16(21)19-15-6-4-13(5-7-15)17(22)23/h4-7,11-12H,2-3,8,10H2,1H3,(H,19,21)(H,22,23)/b14-11- |
| InChIKey | NVGUOVLYDSPFEL-KAMYIIQDSA-N |
| XLogP | 2.46 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|