C15H15N3O5S — CID 108823338
4-[[(Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)amino]prop-2-enoyl]amino]benzoic acid (PubChem CID 108823338) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)amino]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)amino]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108823338 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)amino]prop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C/NC1CCS(=O)(=O)C1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H15N3O5S/c16-7-11(8-17-13-5-6-24(22,23)9-13)14(19)18-12-3-1-10(2-4-12)15(20)21/h1-4,8,13,17H,5-6,9H2,(H,18,19)(H,20,21)/b11-8- |
| InChIKey | BJWYCRZAOQJPDL-FLIBITNWSA-N |
| XLogP | 0.51 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|