C14H13ClN4O5S — CID 108852320
(Z)-N-(4-chloro-3-nitrophenyl)-2-cyano-3-[(1,1-dioxothiolan-3-yl)amino]prop-2-enamide (PubChem CID 108852320) has the molecular formula C14H13ClN4O5S and a molecular weight of 384.80 g/mol. Its IUPAC name is (Z)-N-(4-chloro-3-nitrophenyl)-2-cyano-3-[(1,1-dioxothiolan-3-yl)amino]prop-2-enamide.
| Compound Name | (Z)-N-(4-chloro-3-nitrophenyl)-2-cyano-3-[(1,1-dioxothiolan-3-yl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108852320 |
| Molecular Formula | C14H13ClN4O5S |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | (Z)-N-(4-chloro-3-nitrophenyl)-2-cyano-3-[(1,1-dioxothiolan-3-yl)amino]prop-2-enamide |
| SMILES | N#C/C(=C/NC1CCS(=O)(=O)C1)C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13ClN4O5S/c15-12-2-1-10(5-13(12)19(21)22)18-14(20)9(6-16)7-17-11-3-4-25(23,24)8-11/h1-2,5,7,11,17H,3-4,8H2,(H,18,20)/b9-7- |
| InChIKey | ARRNOFSVTANTNL-CLFYSBASSA-N |
| XLogP | 1.37 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|