C18H15ClN4O3 — CID 108824235
ethyl 4-[[(Z)-3-[(4-chloro-2-pyridinyl)amino]-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 108824235) has the molecular formula C18H15ClN4O3 and a molecular weight of 370.80 g/mol. Its IUPAC name is ethyl 4-[[(Z)-3-[(4-chloro-2-pyridinyl)amino]-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 4-[[(Z)-3-[(4-chloro-2-pyridinyl)amino]-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108824235 |
| Molecular Formula | C18H15ClN4O3 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | ethyl 4-[[(Z)-3-[(4-chloro-2-pyridinyl)amino]-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)/C(C#N)=C\Nc2cc(Cl)ccn2)cc1 |
| InChI | InChI=1S/C18H15ClN4O3/c1-2-26-18(25)12-3-5-15(6-4-12)23-17(24)13(10-20)11-22-16-9-14(19)7-8-21-16/h3-9,11H,2H2,1H3,(H,21,22)(H,23,24)/b13-11- |
| InChIKey | XZJQOCIMJOTQFU-QBFSEMIESA-N |
| XLogP | 3.37 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|