C21H20F3N3O — CID 108826421
(Z)-3-(2-butan-2-ylanilino)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 108826421) has the molecular formula C21H20F3N3O and a molecular weight of 387.41 g/mol. Its IUPAC name is (Z)-3-(2-butan-2-ylanilino)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-3-(2-butan-2-ylanilino)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108826421 |
| Molecular Formula | C21H20F3N3O |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (Z)-3-(2-butan-2-ylanilino)-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCC(C)c1ccccc1N/C=C(/C#N)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H20F3N3O/c1-3-14(2)18-9-4-5-10-19(18)26-13-15(12-25)20(28)27-17-8-6-7-16(11-17)21(22,23)24/h4-11,13-14,26H,3H2,1-2H3,(H,27,28)/b15-13- |
| InChIKey | JHLUZJFXHSSSIT-SQFISAMPSA-N |
| XLogP | 5.68 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|