C19H25N3O3S — CID 108828186
(Z)-N-(4-butylphenyl)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-2-enamide (PubChem CID 108828186) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is (Z)-N-(4-butylphenyl)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-2-enamide.
| Compound Name | (Z)-N-(4-butylphenyl)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108828186 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (Z)-N-(4-butylphenyl)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-methylamino]prop-2-enamide |
| SMILES | CCCCc1ccc(NC(=O)/C(C#N)=C\N(C)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-3-4-5-15-6-8-17(9-7-15)21-19(23)16(12-20)13-22(2)18-10-11-26(24,25)14-18/h6-9,13,18H,3-5,10-11,14H2,1-2H3,(H,21,23)/b16-13- |
| InChIKey | UFQPNAKZRSBPCC-SSZFMOIBSA-N |
| XLogP | 2.49 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|