C20H21Cl2N3O — CID 108828978
(Z)-3-(1-adamantylamino)-2-cyano-N-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 108828978) has the molecular formula C20H21Cl2N3O and a molecular weight of 390.31 g/mol. Its IUPAC name is (Z)-3-(1-adamantylamino)-2-cyano-N-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-(1-adamantylamino)-2-cyano-N-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108828978 |
| Molecular Formula | C20H21Cl2N3O |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | (Z)-3-(1-adamantylamino)-2-cyano-N-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/NC12CC3CC(CC(C3)C1)C2)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H21Cl2N3O/c21-16-1-2-18(17(22)6-16)25-19(26)15(10-23)11-24-20-7-12-3-13(8-20)5-14(4-12)9-20/h1-2,6,11-14,24H,3-5,7-9H2,(H,25,26)/b15-11- |
| InChIKey | BDRSIJMXWWLEIC-PTNGSMBKSA-N |
| XLogP | 4.90 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|