C17H17FN2O4S — CID 10883011
N-(ethylcarbamoyl)-4-fluoro-N-(4-methylsulfonylphenyl)benzamide (PubChem CID 10883011) has the molecular formula C17H17FN2O4S and a molecular weight of 364.40 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-4-fluoro-N-(4-methylsulfonylphenyl)benzamide.
| Compound Name | N-(ethylcarbamoyl)-4-fluoro-N-(4-methylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 10883011 |
| Molecular Formula | C17H17FN2O4S |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-(ethylcarbamoyl)-4-fluoro-N-(4-methylsulfonylphenyl)benzamide |
| SMILES | CCNC(=O)N(C(=O)c1ccc(F)cc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H17FN2O4S/c1-3-19-17(22)20(16(21)12-4-6-13(18)7-5-12)14-8-10-15(11-9-14)25(2,23)24/h4-11H,3H2,1-2H3,(H,19,22) |
| InChIKey | VCQJTDXMHYGFHS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |