C20H21NO5S — CID 10883582
methyl (E)-2-acetamido-3-[2-[(4-methylphenyl)sulfonylmethyl]phenyl]prop-2-enoate (PubChem CID 10883582) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is methyl (E)-2-acetamido-3-[2-[(4-methylphenyl)sulfonylmethyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-2-acetamido-3-[2-[(4-methylphenyl)sulfonylmethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 10883582 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | methyl (E)-2-acetamido-3-[2-[(4-methylphenyl)sulfonylmethyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C(=C\c1ccccc1CS(=O)(=O)c1ccc(C)cc1)NC(C)=O |
| InChI | InChI=1S/C20H21NO5S/c1-14-8-10-18(11-9-14)27(24,25)13-17-7-5-4-6-16(17)12-19(20(23)26-3)21-15(2)22/h4-12H,13H2,1-3H3,(H,21,22)/b19-12+ |
| InChIKey | TXKBAEWPIJYPLB-XDHOZWIPSA-N |
| XLogP | 2.62 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|