C21H23N3O3 — CID 108838867
(Z)-2-cyano-3-(2-methoxy-5-methylanilino)-N-[2-(4-methoxyphenyl)ethyl]prop-2-enamide (PubChem CID 108838867) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-methoxy-5-methylanilino)-N-[2-(4-methoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-methoxy-5-methylanilino)-N-[2-(4-methoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108838867 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (Z)-2-cyano-3-(2-methoxy-5-methylanilino)-N-[2-(4-methoxyphenyl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(CCNC(=O)/C(C#N)=C\Nc2cc(C)ccc2OC)cc1 |
| InChI | InChI=1S/C21H23N3O3/c1-15-4-9-20(27-3)19(12-15)24-14-17(13-22)21(25)23-11-10-16-5-7-18(26-2)8-6-16/h4-9,12,14,24H,10-11H2,1-3H3,(H,23,25)/b17-14- |
| InChIKey | DIPRZMOGFPFQJC-VKAVYKQESA-N |
| XLogP | 3.19 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|