C22H40O5Si — CID 10884149
[(2S,3R)-2-[(Z)-but-2-enyl]oxan-3-yl] (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloxane-2-carboxylate (PubChem CID 10884149) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is [(2S,3R)-2-[(Z)-but-2-enyl]oxan-3-yl] (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloxane-2-carboxylate.
| Compound Name | [(2S,3R)-2-[(Z)-but-2-enyl]oxan-3-yl] (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 10884149 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | [(2S,3R)-2-[(Z)-but-2-enyl]oxan-3-yl] (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyloxane-2-carboxylate |
| SMILES | C/C=C\C[C@@H]1OCCC[C@H]1OC(=O)[C@@]1(C)OCCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O5Si/c1-8-9-12-17-18(13-10-15-24-17)26-20(23)22(5)19(14-11-16-25-22)27-28(6,7)21(2,3)4/h8-9,17-19H,10-16H2,1-7H3/b9-8-/t17-,18+,19-,22-/m0/s1 |
| InChIKey | JTWZOGLXOTTYOB-MFJYXUCDSA-N |
| XLogP | 5.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|