C20H38O4Si — CID 102385689
(3R,4S,5R,6S)-6-[(2S)-but-3-en-2-yl]-3-methoxy-5-methyl-4-tri(propan-2-yl)silyloxyoxan-2-one (PubChem CID 102385689) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is (3R,4S,5R,6S)-6-[(2S)-but-3-en-2-yl]-3-methoxy-5-methyl-4-tri(propan-2-yl)silyloxyoxan-2-one.
| Compound Name | (3R,4S,5R,6S)-6-[(2S)-but-3-en-2-yl]-3-methoxy-5-methyl-4-tri(propan-2-yl)silyloxyoxan-2-one |
|---|---|
| PubChem CID | 102385689 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (3R,4S,5R,6S)-6-[(2S)-but-3-en-2-yl]-3-methoxy-5-methyl-4-tri(propan-2-yl)silyloxyoxan-2-one |
| SMILES | C=C[C@H](C)[C@@H]1OC(=O)[C@H](OC)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1C |
| InChI | InChI=1S/C20H38O4Si/c1-11-15(8)17-16(9)18(19(22-10)20(21)23-17)24-25(12(2)3,13(4)5)14(6)7/h11-19H,1H2,2-10H3/t15-,16+,17-,18-,19+/m0/s1 |
| InChIKey | JCMYTHTYDWYTNE-XCDZQEORSA-N |
| XLogP | 4.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|