C23H48O4Si2 — CID 11719238
(2R,3S,4R,5S,6S)-2-methoxy-4,6-dimethyl-5-trimethylsilyloxy-3-tri(propan-2-yl)silyloxyoct-7-enal (PubChem CID 11719238) has the molecular formula C23H48O4Si2 and a molecular weight of 444.81 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-2-methoxy-4,6-dimethyl-5-trimethylsilyloxy-3-tri(propan-2-yl)silyloxyoct-7-enal.
| Compound Name | (2R,3S,4R,5S,6S)-2-methoxy-4,6-dimethyl-5-trimethylsilyloxy-3-tri(propan-2-yl)silyloxyoct-7-enal |
|---|---|
| PubChem CID | 11719238 |
| Molecular Formula | C23H48O4Si2 |
| Molecular Weight | 444.81 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | (2R,3S,4R,5S,6S)-2-methoxy-4,6-dimethyl-5-trimethylsilyloxy-3-tri(propan-2-yl)silyloxyoct-7-enal |
| SMILES | C=C[C@H](C)[C@H](O[Si](C)(C)C)[C@@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C=O)OC |
| InChI | InChI=1S/C23H48O4Si2/c1-14-19(8)22(26-28(11,12)13)20(9)23(21(15-24)25-10)27-29(16(2)3,17(4)5)18(6)7/h14-23H,1H2,2-13H3/t19-,20+,21-,22-,23-/m0/s1 |
| InChIKey | HBSWYNFTTKIKMH-SPHOGXRMSA-N |
| XLogP | 6.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.81 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|