C24H48O5Si2 — CID 101451496
methyl 2-[(2R,3R,5S,6S)-6-[(2S)-but-3-en-2-yl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]acetate (PubChem CID 101451496) has the molecular formula C24H48O5Si2 and a molecular weight of 472.82 g/mol. Its IUPAC name is methyl 2-[(2R,3R,5S,6S)-6-[(2S)-but-3-en-2-yl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,5S,6S)-6-[(2S)-but-3-en-2-yl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]acetate |
|---|---|
| PubChem CID | 101451496 |
| Molecular Formula | C24H48O5Si2 |
| Molecular Weight | 472.82 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | methyl 2-[(2R,3R,5S,6S)-6-[(2S)-but-3-en-2-yl]-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]acetate |
| SMILES | C=C[C@H](C)[C@@H]1O[C@H](CC(=O)OC)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O5Si2/c1-14-17(2)22-20(29-31(12,13)24(6,7)8)15-19(18(27-22)16-21(25)26-9)28-30(10,11)23(3,4)5/h14,17-20,22H,1,15-16H2,2-13H3/t17-,18+,19+,20-,22-/m0/s1 |
| InChIKey | LVCQLQUOIOPRPR-MOFJNDHNSA-N |
| XLogP | 6.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.82 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|