C29H54O8Si — CID 16732247
[(3S,4R,5S,6R,7S)-9-[(4R,5R,6R)-2,2-ditert-butyl-6-ethyl-5-methyl-1,3,2-dioxasilinan-4-yl]-6-hydroxy-3-methoxy-5,7-dimethyl-8-oxonon-1-en-4-yl] 2-methoxyacetate (PubChem CID 16732247) has the molecular formula C29H54O8Si and a molecular weight of 558.83 g/mol. Its IUPAC name is [(3S,4R,5S,6R,7S)-9-[(4R,5R,6R)-2,2-ditert-butyl-6-ethyl-5-methyl-1,3,2-dioxasilinan-4-yl]-6-hydroxy-3-methoxy-5,7-dimethyl-8-oxonon-1-en-4-yl] 2-methoxyacetate.
| Compound Name | [(3S,4R,5S,6R,7S)-9-[(4R,5R,6R)-2,2-ditert-butyl-6-ethyl-5-methyl-1,3,2-dioxasilinan-4-yl]-6-hydroxy-3-methoxy-5,7-dimethyl-8-oxonon-1-en-4-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 16732247 |
| Molecular Formula | C29H54O8Si |
| Molecular Weight | 558.83 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | [(3S,4R,5S,6R,7S)-9-[(4R,5R,6R)-2,2-ditert-butyl-6-ethyl-5-methyl-1,3,2-dioxasilinan-4-yl]-6-hydroxy-3-methoxy-5,7-dimethyl-8-oxonon-1-en-4-yl] 2-methoxyacetate |
| SMILES | C=C[C@H](OC)[C@H](OC(=O)COC)[C@@H](C)[C@@H](O)[C@H](C)C(=O)C[C@H]1O[Si](C(C)(C)C)(C(C)(C)C)O[C@H](CC)[C@H]1C |
| InChI | InChI=1S/C29H54O8Si/c1-14-22-19(4)24(37-38(36-22,28(6,7)8)29(9,10)11)16-21(30)18(3)26(32)20(5)27(23(15-2)34-13)35-25(31)17-33-12/h15,18-20,22-24,26-27,32H,2,14,16-17H2,1,3-13H3/t18-,19-,20+,22-,23+,24-,26+,27-/m1/s1 |
| InChIKey | JTMISAXIRPHFNV-SYGJTYIISA-N |
| XLogP | 5.21 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.83 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|