C28H52O7Si — CID 16732071
[(3S,4R,5S,6S,7R)-9-[(4R,5R,6R)-2,2-ditert-butyl-6-ethyl-5-methyl-1,3,2-dioxasilinan-4-yl]-6-hydroxy-3-methoxy-5,7-dimethyl-8-oxonon-1-en-4-yl] acetate (PubChem CID 16732071) has the molecular formula C28H52O7Si and a molecular weight of 528.80 g/mol. Its IUPAC name is [(3S,4R,5S,6S,7R)-9-[(4R,5R,6R)-2,2-ditert-butyl-6-ethyl-5-methyl-1,3,2-dioxasilinan-4-yl]-6-hydroxy-3-methoxy-5,7-dimethyl-8-oxonon-1-en-4-yl] acetate.
| Compound Name | [(3S,4R,5S,6S,7R)-9-[(4R,5R,6R)-2,2-ditert-butyl-6-ethyl-5-methyl-1,3,2-dioxasilinan-4-yl]-6-hydroxy-3-methoxy-5,7-dimethyl-8-oxonon-1-en-4-yl] acetate |
|---|---|
| PubChem CID | 16732071 |
| Molecular Formula | C28H52O7Si |
| Molecular Weight | 528.80 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | [(3S,4R,5S,6S,7R)-9-[(4R,5R,6R)-2,2-ditert-butyl-6-ethyl-5-methyl-1,3,2-dioxasilinan-4-yl]-6-hydroxy-3-methoxy-5,7-dimethyl-8-oxonon-1-en-4-yl] acetate |
| SMILES | C=C[C@H](OC)[C@H](OC(C)=O)[C@@H](C)[C@H](O)[C@@H](C)C(=O)C[C@H]1O[Si](C(C)(C)C)(C(C)(C)C)O[C@H](CC)[C@H]1C |
| InChI | InChI=1S/C28H52O7Si/c1-14-22-18(4)24(35-36(34-22,27(7,8)9)28(10,11)12)16-21(30)17(3)25(31)19(5)26(33-20(6)29)23(15-2)32-13/h15,17-19,22-26,31H,2,14,16H2,1,3-13H3/t17-,18+,19-,22+,23-,24+,25+,26+/m0/s1 |
| InChIKey | QXKNNUNENNRNNQ-AHGFRHGDSA-N |
| XLogP | 5.58 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.80 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|