C29H50O8Si — CID 11157170
prop-2-enyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-2-[(3R)-4-hydroxy-3-methyl-2-methylidenebutyl]-4-methyl-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate (PubChem CID 11157170) has the molecular formula C29H50O8Si and a molecular weight of 554.80 g/mol. Its IUPAC name is prop-2-enyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-2-[(3R)-4-hydroxy-3-methyl-2-methylidenebutyl]-4-methyl-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate.
| Compound Name | prop-2-enyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-2-[(3R)-4-hydroxy-3-methyl-2-methylidenebutyl]-4-methyl-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
|---|---|
| PubChem CID | 11157170 |
| Molecular Formula | C29H50O8Si |
| Molecular Weight | 554.80 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | prop-2-enyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-2-[(3R)-4-hydroxy-3-methyl-2-methylidenebutyl]-4-methyl-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
| SMILES | C=CCOC(=O)C[C@H]1C[C@H](OC(C)=O)C[C@@]2(C[C@@](C)(O[Si](CC)(CC)CC)C[C@H](CC(=C)[C@@H](C)CO)O2)O1 |
| InChI | InChI=1S/C29H50O8Si/c1-9-13-33-27(32)16-24-15-25(34-23(7)31)18-29(35-24)20-28(8,37-38(10-2,11-3)12-4)17-26(36-29)14-21(5)22(6)19-30/h9,22,24-26,30H,1,5,10-20H2,2-4,6-8H3/t22-,24+,25-,26-,28-,29+/m0/s1 |
| InChIKey | ICHDHCKCQYYWLI-KTANAYMNSA-N |
| XLogP | 5.45 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.80 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|