C26H46O7 — CID 101244646
(2R)-2-[(4S,5R,6S)-6-[(2S)-4-[(4R,5R,6S)-6-[(2S,3R)-3-hydroxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-4-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid (PubChem CID 101244646) has the molecular formula C26H46O7 and a molecular weight of 470.65 g/mol. Its IUPAC name is (2R)-2-[(4S,5R,6S)-6-[(2S)-4-[(4R,5R,6S)-6-[(2S,3R)-3-hydroxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-4-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid.
| Compound Name | (2R)-2-[(4S,5R,6S)-6-[(2S)-4-[(4R,5R,6S)-6-[(2S,3R)-3-hydroxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-4-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid |
|---|---|
| PubChem CID | 101244646 |
| Molecular Formula | C26H46O7 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | (2R)-2-[(4S,5R,6S)-6-[(2S)-4-[(4R,5R,6S)-6-[(2S,3R)-3-hydroxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]pent-4-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid |
| SMILES | C=C(C[C@H](C)[C@@H]1OC(C)(C)O[C@H]([C@@H](C)C(=O)O)[C@@H]1C)[C@@H]1OC(C)(C)O[C@@H]([C@@H](C)[C@@H](C)O)[C@H]1C |
| InChI | InChI=1S/C26H46O7/c1-13(20-16(4)22(15(3)19(7)27)32-25(8,9)30-20)12-14(2)21-17(5)23(18(6)24(28)29)33-26(10,11)31-21/h14-23,27H,1,12H2,2-11H3,(H,28,29)/t14-,15-,16-,17+,18+,19+,20-,21-,22-,23-/m0/s1 |
| InChIKey | MFANOUODUXSHEI-QUJASINTSA-N |
| XLogP | 4.62 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|